C13H8Cl2F3NO — CID 71391087
4-[2,4-dichloro-6-(trifluoromethyl)phenoxy]aniline (PubChem CID 71391087) has the molecular formula C13H8Cl2F3NO and a molecular weight of 322.11 g/mol. Its IUPAC name is 4-[2,4-dichloro-6-(trifluoromethyl)phenoxy]aniline.
| Compound Name | 4-[2,4-dichloro-6-(trifluoromethyl)phenoxy]aniline |
|---|---|
| PubChem CID | 71391087 |
| Molecular Formula | C13H8Cl2F3NO |
| Molecular Weight | 322.11 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 4-[2,4-dichloro-6-(trifluoromethyl)phenoxy]aniline |
| SMILES | Nc1ccc(Oc2c(Cl)cc(Cl)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H8Cl2F3NO/c14-7-5-10(13(16,17)18)12(11(15)6-7)20-9-3-1-8(19)2-4-9/h1-6H,19H2 |
| InChIKey | CGHYLZALWIJOIG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.11 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|