C12F20 — CID 71391659
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,2,3,4,4,5,5,6,6-nonafluorocyclohex-2-en-1-yl)cyclohexane (PubChem CID 71391659) has the molecular formula C12F20 and a molecular weight of 524.09 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,2,3,4,4,5,5,6,6-nonafluorocyclohex-2-en-1-yl)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,2,3,4,4,5,5,6,6-nonafluorocyclohex-2-en-1-yl)cyclohexane |
|---|---|
| PubChem CID | 71391659 |
| Molecular Formula | C12F20 |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(1,2,3,4,4,5,5,6,6-nonafluorocyclohex-2-en-1-yl)cyclohexane |
| SMILES | FC1=C(F)C(F)(C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F20/c13-1-2(14)4(16,17)7(21,22)6(19,20)3(1,15)5(18)8(23,24)10(27,28)12(31,32)11(29,30)9(5,25)26 |
| InChIKey | QPHQYIDNCAUAOM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|