C18H21NO4 — CID 7139566
(2R)-2-azaniumyl-2-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]acetate (PubChem CID 7139566) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2R)-2-azaniumyl-2-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]acetate.
| Compound Name | (2R)-2-azaniumyl-2-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 7139566 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2R)-2-azaniumyl-2-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]acetate |
| SMILES | CCOc1cc([C@@H]([NH3+])C(=O)[O-])ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-3-22-16-10-14(17(19)18(20)21)8-9-15(16)23-11-13-6-4-12(2)5-7-13/h4-10,17H,3,11,19H2,1-2H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | BQAIECLEUVBCHC-QGZVFWFLSA-N |
| XLogP | 1.01 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |