C14H21NO4 — CID 7139568
(2S)-2-azaniumyl-2-(4-butoxy-3-ethoxyphenyl)acetate (PubChem CID 7139568) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (2S)-2-azaniumyl-2-(4-butoxy-3-ethoxyphenyl)acetate.
| Compound Name | (2S)-2-azaniumyl-2-(4-butoxy-3-ethoxyphenyl)acetate |
|---|---|
| PubChem CID | 7139568 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (2S)-2-azaniumyl-2-(4-butoxy-3-ethoxyphenyl)acetate |
| SMILES | CCCCOc1ccc([C@H]([NH3+])C(=O)[O-])cc1OCC |
| InChI | InChI=1S/C14H21NO4/c1-3-5-8-19-11-7-6-10(13(15)14(16)17)9-12(11)18-4-2/h6-7,9,13H,3-5,8,15H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | IXKZGXAVSKFUBR-ZDUSSCGKSA-N |
| XLogP | 0.30 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|