C8H12N2O4 — CID 71408042
[(4S,5S)-4-ethyl-2,6-dioxo-1,3-diazinan-5-yl] acetate (PubChem CID 71408042) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is [(4S,5S)-4-ethyl-2,6-dioxo-1,3-diazinan-5-yl] acetate.
| Compound Name | [(4S,5S)-4-ethyl-2,6-dioxo-1,3-diazinan-5-yl] acetate |
|---|---|
| PubChem CID | 71408042 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | [(4S,5S)-4-ethyl-2,6-dioxo-1,3-diazinan-5-yl] acetate |
| SMILES | CC[C@@H]1NC(=O)NC(=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C8H12N2O4/c1-3-5-6(14-4(2)11)7(12)10-8(13)9-5/h5-6H,3H2,1-2H3,(H2,9,10,12,13)/t5-,6-/m0/s1 |
| InChIKey | MPHJMLJYDGLEMC-WDSKDSINSA-N |
| XLogP | -0.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |