C14H20O2 — CID 71408786
2,5,5,9-tetramethyl-6-oxodeca-2,7,9-trienal (PubChem CID 71408786) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,5,5,9-tetramethyl-6-oxodeca-2,7,9-trienal.
| Compound Name | 2,5,5,9-tetramethyl-6-oxodeca-2,7,9-trienal |
|---|---|
| PubChem CID | 71408786 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,5,5,9-tetramethyl-6-oxodeca-2,7,9-trienal |
| SMILES | C=C(C)C=CC(=O)C(C)(C)CC=C(C)C=O |
| InChI | InChI=1S/C14H20O2/c1-11(2)6-7-13(16)14(4,5)9-8-12(3)10-15/h6-8,10H,1,9H2,2-5H3 |
| InChIKey | HCQDWABYGMQDLT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|