C10H17NO2 — CID 177166847
(4Z)-7-hydroxy-2,2,5-trimethylhepta-4,6-dienamide (PubChem CID 177166847) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (4Z)-7-hydroxy-2,2,5-trimethylhepta-4,6-dienamide.
| Compound Name | (4Z)-7-hydroxy-2,2,5-trimethylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 177166847 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (4Z)-7-hydroxy-2,2,5-trimethylhepta-4,6-dienamide |
| SMILES | C/C(C=CO)=C/CC(C)(C)C(N)=O |
| InChI | InChI=1S/C10H17NO2/c1-8(5-7-12)4-6-10(2,3)9(11)13/h4-5,7,12H,6H2,1-3H3,(H2,11,13)/b7-5?,8-4- |
| InChIKey | XKYDZTZHFPALFV-HDGFRDIJSA-N |
| XLogP | 1.91 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|