About (but-2-enylamino) acetate
(but-2-enylamino) acetate (PubChem CID 71411992) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is (but-2-enylamino) acetate.
Molecular Properties
| Compound Name | (but-2-enylamino) acetate |
| PubChem CID | 71411992 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (but-2-enylamino) acetate |
| SMILES | CC=CCNOC(C)=O |
| InChI | InChI=1S/C6H11NO2/c1-3-4-5-7-9-6(2)8/h3-4,7H,5H2,1-2H3 |
| InChIKey | PUJFSUOZPAKWME-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (but-2-enylamino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (but-2-enylamino) acetate?
The IUPAC name of (but-2-enylamino) acetate (CID 71411992) is (but-2-enylamino) acetate.
What is the SMILES notation for (but-2-enylamino) acetate?
The canonical SMILES for (but-2-enylamino) acetate is CC=CCNOC(C)=O.
What is the InChIKey of (but-2-enylamino) acetate?
The InChIKey is PUJFSUOZPAKWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-3-4-5-7-9-6(2)8/h3-4,7H,5H2,1-2H3.
What are the key properties of (but-2-enylamino) acetate?
(but-2-enylamino) acetate has a molecular weight of 129.16 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (but-2-enylamino) acetate is sourced from PubChem (CID 71411992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).