C14H18O3 — CID 71413804
methyl 5-(4-hydroxy-3,5-dimethylphenyl)pent-4-enoate (PubChem CID 71413804) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is methyl 5-(4-hydroxy-3,5-dimethylphenyl)pent-4-enoate.
| Compound Name | methyl 5-(4-hydroxy-3,5-dimethylphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 71413804 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | methyl 5-(4-hydroxy-3,5-dimethylphenyl)pent-4-enoate |
| SMILES | COC(=O)CCC=Cc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C14H18O3/c1-10-8-12(9-11(2)14(10)16)6-4-5-7-13(15)17-3/h4,6,8-9,16H,5,7H2,1-3H3 |
| InChIKey | QVRHRCYQKPJDNA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |