C13H22N4O3 — CID 71413889
3-[bis[2-(2-cyanoethoxy)ethyl]amino]propanamide (PubChem CID 71413889) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-[bis[2-(2-cyanoethoxy)ethyl]amino]propanamide.
| Compound Name | 3-[bis[2-(2-cyanoethoxy)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 71413889 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-[bis[2-(2-cyanoethoxy)ethyl]amino]propanamide |
| SMILES | N#CCCOCCN(CCOCCC#N)CCC(N)=O |
| InChI | InChI=1S/C13H22N4O3/c14-4-1-9-19-11-7-17(6-3-13(16)18)8-12-20-10-2-5-15/h1-3,6-12H2,(H2,16,18) |
| InChIKey | FKZHEQZWYPITAU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|