C26H49N11O7 — CID 172960201
3-[2-[(3E)-3-amino-3-hydroxyiminopropoxy]ethyl-[2-[(3Z)-3-amino-3-hydroxyiminopropoxy]ethyl]amino]-N'-hydroxypropanimidamide;3-[bis[2-(2-cyanoethoxy)ethyl]amino]propanenitrile (PubChem CID 172960201) has the molecular formula C26H49N11O7 and a molecular weight of 627.75 g/mol. Its IUPAC name is 3-[2-[(3E)-3-amino-3-hydroxyiminopropoxy]ethyl-[2-[(3Z)-3-amino-3-hydroxyiminopropoxy]ethyl]amino]-N'-hydroxypropanimidamide;3-[bis[2-(2-cyanoethoxy)ethyl]amino]propanenitrile.
| Compound Name | 3-[2-[(3E)-3-amino-3-hydroxyiminopropoxy]ethyl-[2-[(3Z)-3-amino-3-hydroxyiminopropoxy]ethyl]amino]-N'-hydroxypropanimidamide;3-[bis[2-(2-cyanoethoxy)ethyl]amino]propanenitrile |
|---|---|
| PubChem CID | 172960201 |
| Molecular Formula | C26H49N11O7 |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.38 |
| IUPAC Name | 3-[2-[(3E)-3-amino-3-hydroxyiminopropoxy]ethyl-[2-[(3Z)-3-amino-3-hydroxyiminopropoxy]ethyl]amino]-N'-hydroxypropanimidamide;3-[bis[2-(2-cyanoethoxy)ethyl]amino]propanenitrile |
| SMILES | N#CCCOCCN(CCC#N)CCOCCC#N.N/C(CCOCCN(CCOCC/C(N)=N\O)CC/C(N)=N/O)=N\O |
| InChI | InChI=1S/C13H29N7O5.C13H20N4O2/c14-11(17-21)1-4-20(5-9-24-7-2-12(15)18-22)6-10-25-8-3-13(16)19-23;14-4-1-7-17(8-12-18-10-2-5-15)9-13-19-11-3-6-16/h21-23H,1-10H2,(H2,14,17)(H2,15,18)(H2,16,19);1-3,7-13H2 |
| InChIKey | AHTZDLRRYJKNSB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 290.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|