C9H14N2O2 — CID 71418704
1,3-dimethyl-5-propylpyrimidine-2,4-dione (PubChem CID 71418704) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1,3-dimethyl-5-propylpyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71418704 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1,3-dimethyl-5-propylpyrimidine-2,4-dione |
| SMILES | CCCc1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H14N2O2/c1-4-5-7-6-10(2)9(13)11(3)8(7)12/h6H,4-5H2,1-3H3 |
| InChIKey | ATVGUGAIBQWUIZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |