C10H7F9N2O2 — CID 164681703
1,3-dimethyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione (PubChem CID 164681703) has the molecular formula C10H7F9N2O2 and a molecular weight of 358.16 g/mol. Its IUPAC name is 1,3-dimethyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164681703 |
| Molecular Formula | C10H7F9N2O2 |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 1,3-dimethyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione |
| SMILES | Cn1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H7F9N2O2/c1-20-3-4(5(22)21(2)6(20)23)7(11,12)8(13,14)9(15,16)10(17,18)19/h3H,1-2H3 |
| InChIKey | KDLACOWIZSXROD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|