C11H11F9N2O2 — CID 178169158
ethane;1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione (PubChem CID 178169158) has the molecular formula C11H11F9N2O2 and a molecular weight of 374.20 g/mol. Its IUPAC name is ethane;1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione.
| Compound Name | ethane;1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178169158 |
| Molecular Formula | C11H11F9N2O2 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | ethane;1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrimidine-2,4-dione |
| SMILES | CC.Cn1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H5F9N2O2.C2H6/c1-20-2-3(4(21)19-5(20)22)6(10,11)7(12,13)8(14,15)9(16,17)18;1-2/h2H,1H3,(H,19,21,22);1-2H3 |
| InChIKey | BJDSPWRFYHORSB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|