C12H16N2S — CID 71422010
(4S,5S)-4-ethyl-5-phenyl-1,3-diazinane-2-thione (PubChem CID 71422010) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is (4S,5S)-4-ethyl-5-phenyl-1,3-diazinane-2-thione.
| Compound Name | (4S,5S)-4-ethyl-5-phenyl-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 71422010 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (4S,5S)-4-ethyl-5-phenyl-1,3-diazinane-2-thione |
| SMILES | CC[C@@H]1NC(=S)NC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H16N2S/c1-2-11-10(8-13-12(15)14-11)9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3,(H2,13,14,15)/t10-,11+/m1/s1 |
| InChIKey | AISQVHHFGGDOAO-MNOVXSKESA-N |
| XLogP | 2.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|