C19H29NO3 — CID 71427288
1,4-dihexyl-5-methylfuro[3,4-c]pyrrole-3,6-dione (PubChem CID 71427288) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1,4-dihexyl-5-methylfuro[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-dihexyl-5-methylfuro[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 71427288 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1,4-dihexyl-5-methylfuro[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCC1=C2C(=O)N(C)C(CCCCCC)=C2C(=O)O1 |
| InChI | InChI=1S/C19H29NO3/c1-4-6-8-10-12-14-16-17(18(21)20(14)3)15(23-19(16)22)13-11-9-7-5-2/h4-13H2,1-3H3 |
| InChIKey | FRCPDZFYVBXTAR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|