C15H12I3NO7S — CID 71431799
(2S)-2-amino-3-[4-hydroxy-3,5-diiodo-2-(3-iodo-4-sulfooxyphenyl)phenyl]propanoic acid (PubChem CID 71431799) has the molecular formula C15H12I3NO7S and a molecular weight of 731.04 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-hydroxy-3,5-diiodo-2-(3-iodo-4-sulfooxyphenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-hydroxy-3,5-diiodo-2-(3-iodo-4-sulfooxyphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 71431799 |
| Molecular Formula | C15H12I3NO7S |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 730.75 |
| IUPAC Name | (2S)-2-amino-3-[4-hydroxy-3,5-diiodo-2-(3-iodo-4-sulfooxyphenyl)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1cc(I)c(O)c(I)c1-c1ccc(OS(=O)(=O)O)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H12I3NO7S/c16-8-3-6(1-2-11(8)26-27(23,24)25)12-7(5-10(19)15(21)22)4-9(17)14(20)13(12)18/h1-4,10,20H,5,19H2,(H,21,22)(H,23,24,25)/t10-/m0/s1 |
| InChIKey | ZHVXGHGIOKZJJW-JTQLQIEISA-N |
| XLogP | 3.01 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|