C24H24N2O3 — CID 71434430
3-[bis[4-(dimethylamino)phenyl]methylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 71434430) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[bis[4-(dimethylamino)phenyl]methylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | 3-[bis[4-(dimethylamino)phenyl]methylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 71434430 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-[bis[4-(dimethylamino)phenyl]methylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=O)C(C(=O)O)=C2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-25(2)19-10-5-16(6-11-19)23(17-7-12-20(13-8-17)26(3)4)18-9-14-22(27)21(15-18)24(28)29/h5-15H,1-4H3,(H,28,29) |
| InChIKey | LUORLSVZCKSBSO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|