C24H25N3O3 — CID 102445105
3-amino-5-[bis[4-(dimethylamino)phenyl]methylidene]-6-oxocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 102445105) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 3-amino-5-[bis[4-(dimethylamino)phenyl]methylidene]-6-oxocyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 3-amino-5-[bis[4-(dimethylamino)phenyl]methylidene]-6-oxocyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 102445105 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-amino-5-[bis[4-(dimethylamino)phenyl]methylidene]-6-oxocyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CN(C)c1ccc(C(=C2C=C(N)C=C(C(=O)O)C2=O)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-26(2)18-9-5-15(6-10-18)22(16-7-11-19(12-8-16)27(3)4)20-13-17(25)14-21(23(20)28)24(29)30/h5-14H,25H2,1-4H3,(H,29,30) |
| InChIKey | DSMQISRXHCMATP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|