C29H34N2O3 — CID 21131176
3-[bis[4-(diethylamino)phenyl]methylidene]-5-methyl-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 21131176) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 3-[bis[4-(diethylamino)phenyl]methylidene]-5-methyl-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | 3-[bis[4-(diethylamino)phenyl]methylidene]-5-methyl-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 21131176 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-[bis[4-(diethylamino)phenyl]methylidene]-5-methyl-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | CCN(CC)c1ccc(C(=C2C=C(C)C(=O)C(C(=O)O)=C2)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C29H34N2O3/c1-6-30(7-2)24-14-10-21(11-15-24)27(22-12-16-25(17-13-22)31(8-3)9-4)23-18-20(5)28(32)26(19-23)29(33)34/h10-19H,6-9H2,1-5H3,(H,33,34) |
| InChIKey | PBWMTYJZWAMGLZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|