C17H27NO7S2 — CID 71435698
ethyl 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxybutyl]thiophene-2-carboxylate (PubChem CID 71435698) has the molecular formula C17H27NO7S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxybutyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxybutyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 71435698 |
| Molecular Formula | C17H27NO7S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | ethyl 5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxybutyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CCC(CNC(=O)OC(C)(C)C)OS(C)(=O)=O)s1 |
| InChI | InChI=1S/C17H27NO7S2/c1-6-23-15(19)14-10-9-13(26-14)8-7-12(25-27(5,21)22)11-18-16(20)24-17(2,3)4/h9-10,12H,6-8,11H2,1-5H3,(H,18,20) |
| InChIKey | VZCRSHNATWOQCP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|