C11H8N4O9 — CID 71440448
(2,4,6-trinitrophenyl) 5-oxopyrrolidine-2-carboxylate (PubChem CID 71440448) has the molecular formula C11H8N4O9 and a molecular weight of 340.20 g/mol. Its IUPAC name is (2,4,6-trinitrophenyl) 5-oxopyrrolidine-2-carboxylate.
| Compound Name | (2,4,6-trinitrophenyl) 5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 71440448 |
| Molecular Formula | C11H8N4O9 |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (2,4,6-trinitrophenyl) 5-oxopyrrolidine-2-carboxylate |
| SMILES | O=C1CCC(C(=O)Oc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C11H8N4O9/c16-9-2-1-6(12-9)11(17)24-10-7(14(20)21)3-5(13(18)19)4-8(10)15(22)23/h3-4,6H,1-2H2,(H,12,16) |
| InChIKey | OHQGNVGQELARTB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 184.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|