C18H18O3 — CID 71456927
9-hydroxy-6-methoxy-1,1,7-trimethylphenanthren-2-one (PubChem CID 71456927) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 9-hydroxy-6-methoxy-1,1,7-trimethylphenanthren-2-one.
| Compound Name | 9-hydroxy-6-methoxy-1,1,7-trimethylphenanthren-2-one |
|---|---|
| PubChem CID | 71456927 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 9-hydroxy-6-methoxy-1,1,7-trimethylphenanthren-2-one |
| SMILES | COc1cc2c3c(cc(O)c2cc1C)C(C)(C)C(=O)C=C3 |
| InChI | InChI=1S/C18H18O3/c1-10-7-13-12(8-16(10)21-4)11-5-6-17(20)18(2,3)14(11)9-15(13)19/h5-9,19H,1-4H3 |
| InChIKey | LHHLMRGWOMWQSU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |