C16H20O5 — CID 71455986
(1S,4R)-1,4-dihydroxy-7-methoxy-1,6-dimethyl-4-propan-2-ylnaphthalene-2,3-dione (PubChem CID 71455986) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1S,4R)-1,4-dihydroxy-7-methoxy-1,6-dimethyl-4-propan-2-ylnaphthalene-2,3-dione.
| Compound Name | (1S,4R)-1,4-dihydroxy-7-methoxy-1,6-dimethyl-4-propan-2-ylnaphthalene-2,3-dione |
|---|---|
| PubChem CID | 71455986 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (1S,4R)-1,4-dihydroxy-7-methoxy-1,6-dimethyl-4-propan-2-ylnaphthalene-2,3-dione |
| SMILES | COc1cc2c(cc1C)[C@](O)(C(C)C)C(=O)C(=O)[C@@]2(C)O |
| InChI | InChI=1S/C16H20O5/c1-8(2)16(20)11-6-9(3)12(21-5)7-10(11)15(4,19)13(17)14(16)18/h6-8,19-20H,1-5H3/t15-,16+/m0/s1 |
| InChIKey | SSMLCQMNNLXFLS-JKSUJKDBSA-N |
| XLogP | 1.21 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|