C32H47N5O5 — CID 71456966
(3S,6S,9S)-3-(1H-indol-3-ylmethyl)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone (PubChem CID 71456966) has the molecular formula C32H47N5O5 and a molecular weight of 581.76 g/mol. Its IUPAC name is (3S,6S,9S)-3-(1H-indol-3-ylmethyl)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S)-3-(1H-indol-3-ylmethyl)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 71456966 |
| Molecular Formula | C32H47N5O5 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.36 |
| IUPAC Name | (3S,6S,9S)-3-(1H-indol-3-ylmethyl)-9,10-dimethyl-1-(2-methylpropyl)-6-(6-oxooctyl)-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H](C)N(C)C(=O)CCN(CC(C)C)C(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C32H47N5O5/c1-6-24(38)12-8-7-9-15-27-31(41)35-28(18-23-19-33-26-14-11-10-13-25(23)26)32(42)37(20-21(2)3)17-16-29(39)36(5)22(4)30(40)34-27/h10-11,13-14,19,21-22,27-28,33H,6-9,12,15-18,20H2,1-5H3,(H,34,40)(H,35,41)/t22-,27-,28-/m0/s1 |
| InChIKey | WGTHEIXUFRAKFQ-FAQZDJIUSA-N |
| XLogP | 3.34 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|