C26H28N2O5 — CID 71458168
5-methyl-3-[(6,7,10,11-tetramethoxy-3,4-dihydro-1H-phenanthro[9,10-c]pyridin-2-yl)methyl]-1,2-oxazole (PubChem CID 71458168) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 5-methyl-3-[(6,7,10,11-tetramethoxy-3,4-dihydro-1H-phenanthro[9,10-c]pyridin-2-yl)methyl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[(6,7,10,11-tetramethoxy-3,4-dihydro-1H-phenanthro[9,10-c]pyridin-2-yl)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 71458168 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 5-methyl-3-[(6,7,10,11-tetramethoxy-3,4-dihydro-1H-phenanthro[9,10-c]pyridin-2-yl)methyl]-1,2-oxazole |
| SMILES | COc1cc2c3c(c4cc(OC)c(OC)cc4c2cc1OC)CN(Cc1cc(C)on1)CC3 |
| InChI | InChI=1S/C26H28N2O5/c1-15-8-16(27-33-15)13-28-7-6-17-18-9-23(29-2)24(30-3)10-19(18)20-11-25(31-4)26(32-5)12-21(20)22(17)14-28/h8-12H,6-7,13-14H2,1-5H3 |
| InChIKey | LSDGAFIPHHQYJZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|