C25H31NO4 — CID 58349663
[10-(hydroxymethyl)-6,11-dimethoxy-2-(2-methylpropyl)-3,4-dihydro-1H-phenanthro[9,10-c]pyridin-7-yl]methanol (PubChem CID 58349663) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is [10-(hydroxymethyl)-6,11-dimethoxy-2-(2-methylpropyl)-3,4-dihydro-1H-phenanthro[9,10-c]pyridin-7-yl]methanol.
| Compound Name | [10-(hydroxymethyl)-6,11-dimethoxy-2-(2-methylpropyl)-3,4-dihydro-1H-phenanthro[9,10-c]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 58349663 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | [10-(hydroxymethyl)-6,11-dimethoxy-2-(2-methylpropyl)-3,4-dihydro-1H-phenanthro[9,10-c]pyridin-7-yl]methanol |
| SMILES | COc1cc2c3c(c4cc(OC)c(CO)cc4c2cc1CO)CN(CC(C)C)CC3 |
| InChI | InChI=1S/C25H31NO4/c1-15(2)11-26-6-5-18-21-9-24(29-3)16(13-27)7-19(21)20-8-17(14-28)25(30-4)10-22(20)23(18)12-26/h7-10,15,27-28H,5-6,11-14H2,1-4H3 |
| InChIKey | IXAHWJWDIGISAC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|