C21H30N2O4 — CID 13136983
8,9-dimethoxy-3-[2-[methyl(propyl)amino]propyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (PubChem CID 13136983) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 8,9-dimethoxy-3-[2-[methyl(propyl)amino]propyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
| Compound Name | 8,9-dimethoxy-3-[2-[methyl(propyl)amino]propyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 13136983 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 8,9-dimethoxy-3-[2-[methyl(propyl)amino]propyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| SMILES | CCCN(C)C(C)CN1CCc2c(c(=O)oc3cc(OC)c(OC)cc23)C1 |
| InChI | InChI=1S/C21H30N2O4/c1-6-8-22(3)14(2)12-23-9-7-15-16-10-19(25-4)20(26-5)11-18(16)27-21(24)17(15)13-23/h10-11,14H,6-9,12-13H2,1-5H3 |
| InChIKey | ZZOQPXQYDQKGEB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|