C21H32Cl2N2O4 — CID 13136997
3-[2-(diethylamino)propyl]-8,9-dimethoxy-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one;dihydrochloride (PubChem CID 13136997) has the molecular formula C21H32Cl2N2O4 and a molecular weight of 447.40 g/mol. Its IUPAC name is 3-[2-(diethylamino)propyl]-8,9-dimethoxy-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one;dihydrochloride.
| Compound Name | 3-[2-(diethylamino)propyl]-8,9-dimethoxy-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one;dihydrochloride |
|---|---|
| PubChem CID | 13136997 |
| Molecular Formula | C21H32Cl2N2O4 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 3-[2-(diethylamino)propyl]-8,9-dimethoxy-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one;dihydrochloride |
| SMILES | CCN(CC)C(C)CN1CCc2c(c(=O)oc3cc(OC)c(OC)cc23)C1.Cl.Cl |
| InChI | InChI=1S/C21H30N2O4.2ClH/c1-6-23(7-2)14(3)12-22-9-8-15-16-10-19(25-4)20(26-5)11-18(16)27-21(24)17(15)13-22;;/h10-11,14H,6-9,12-13H2,1-5H3;2*1H |
| InChIKey | FKOSHJBDHBCJGY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|