C31H35ClN2O4 — CID 71459948
(E)-3-(4-chlorophenyl)-N-[[(1S,2S,6R,14R,15S,16R)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]methyl]prop-2-enamide (PubChem CID 71459948) has the molecular formula C31H35ClN2O4 and a molecular weight of 535.08 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[(1S,2S,6R,14R,15S,16R)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[(1S,2S,6R,14R,15S,16R)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71459948 |
| Molecular Formula | C31H35ClN2O4 |
| Molecular Weight | 535.08 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[(1S,2S,6R,14R,15S,16R)-11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]methyl]prop-2-enamide |
| SMILES | COc1ccc2c3c1O[C@H]1[C@]4(OC)CC[C@@]5(C[C@@H]4CNC(=O)/C=C/c4ccc(Cl)cc4)[C@@H](C2)N(C)CC[C@]315 |
| InChI | InChI=1S/C31H35ClN2O4/c1-34-15-14-30-26-20-7-10-23(36-2)27(26)38-28(30)31(37-3)13-12-29(30,24(34)16-20)17-21(31)18-33-25(35)11-6-19-4-8-22(32)9-5-19/h4-11,21,24,28H,12-18H2,1-3H3,(H,33,35)/b11-6+/t21-,24-,28-,29-,30+,31+/m1/s1 |
| InChIKey | KODQXFPDEKACDT-WJCIMCJESA-N |
| XLogP | 4.62 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.08 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|