C32H38N2O4 — CID 74073059
N-[(11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl)methyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 74073059) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is N-[(11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl)methyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[(11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl)methyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74073059 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | N-[(11,15-dimethoxy-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl)methyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc2c3c1OC1C4(OC)CCC5(CC4CNC(=O)C=Cc4ccc(C)cc4)C(C2)N(C)CCC315 |
| InChI | InChI=1S/C32H38N2O4/c1-20-5-7-21(8-6-20)9-12-26(35)33-19-23-18-30-13-14-32(23,37-4)29-31(30)15-16-34(2)25(30)17-22-10-11-24(36-3)28(38-29)27(22)31/h5-12,23,25,29H,13-19H2,1-4H3,(H,33,35) |
| InChIKey | FLLNTYIXKCHHQH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|