C29H35N3O2 — CID 71460953
N-[[4-(dipropylamino)phenyl]-[(2-phenylacetyl)amino]methyl]-2-phenylacetamide (PubChem CID 71460953) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[[4-(dipropylamino)phenyl]-[(2-phenylacetyl)amino]methyl]-2-phenylacetamide.
| Compound Name | N-[[4-(dipropylamino)phenyl]-[(2-phenylacetyl)amino]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 71460953 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-[[4-(dipropylamino)phenyl]-[(2-phenylacetyl)amino]methyl]-2-phenylacetamide |
| SMILES | CCCN(CCC)c1ccc(C(NC(=O)Cc2ccccc2)NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H35N3O2/c1-3-19-32(20-4-2)26-17-15-25(16-18-26)29(30-27(33)21-23-11-7-5-8-12-23)31-28(34)22-24-13-9-6-10-14-24/h5-18,29H,3-4,19-22H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | ACLRMEGZKLFCJJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|