C24H29NO6 — CID 71461631
oxalic acid;2-phenylethyl (3S,4R)-1-ethyl-4-phenylpiperidine-3-carboxylate (PubChem CID 71461631) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is oxalic acid;2-phenylethyl (3S,4R)-1-ethyl-4-phenylpiperidine-3-carboxylate.
| Compound Name | oxalic acid;2-phenylethyl (3S,4R)-1-ethyl-4-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 71461631 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | oxalic acid;2-phenylethyl (3S,4R)-1-ethyl-4-phenylpiperidine-3-carboxylate |
| SMILES | CCN1CC[C@@H](c2ccccc2)[C@H](C(=O)OCCc2ccccc2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27NO2.C2H2O4/c1-2-23-15-13-20(19-11-7-4-8-12-19)21(17-23)22(24)25-16-14-18-9-5-3-6-10-18;3-1(4)2(5)6/h3-12,20-21H,2,13-17H2,1H3;(H,3,4)(H,5,6)/t20-,21+;/m0./s1 |
| InChIKey | OZCCPRJEWJXRBF-JUDYQFGCSA-N |
| XLogP | 3.05 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|