C30H27N5O — CID 71462014
6-(4-benzylpiperazin-1-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one (PubChem CID 71462014) has the molecular formula C30H27N5O and a molecular weight of 473.58 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one |
|---|---|
| PubChem CID | 71462014 |
| Molecular Formula | C30H27N5O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one |
| SMILES | O=c1cc2n(-c3ccccc3)nc(-c3ccccc3)nc-2cc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H27N5O/c36-29-21-27-26(20-28(29)34-18-16-33(17-19-34)22-23-10-4-1-5-11-23)31-30(24-12-6-2-7-13-24)32-35(27)25-14-8-3-9-15-25/h1-15,20-21H,16-19,22H2 |
| InChIKey | BUYJBANPZYRXIG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |