C18H19FO2 — CID 71462947
(3S,3aR,7aS)-3-[(3-fluoro-4-methoxyphenyl)methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one (PubChem CID 71462947) has the molecular formula C18H19FO2 and a molecular weight of 286.35 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-[(3-fluoro-4-methoxyphenyl)methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one.
| Compound Name | (3S,3aR,7aS)-3-[(3-fluoro-4-methoxyphenyl)methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 71462947 |
| Molecular Formula | C18H19FO2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (3S,3aR,7aS)-3-[(3-fluoro-4-methoxyphenyl)methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one |
| SMILES | C=C1C=CC(=O)[C@@H]2[C@H](Cc3ccc(OC)c(F)c3)CC[C@H]12 |
| InChI | InChI=1S/C18H19FO2/c1-11-3-7-16(20)18-13(5-6-14(11)18)9-12-4-8-17(21-2)15(19)10-12/h3-4,7-8,10,13-14,18H,1,5-6,9H2,2H3/t13-,14+,18+/m0/s1 |
| InChIKey | NTCVXIKUWHXRRO-PMUMKWKESA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |