C24H35BrO4 — CID 71464796
4-bromobutyl (1R,4S,5R,9S,10S,13R)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 71464796) has the molecular formula C24H35BrO4 and a molecular weight of 467.44 g/mol. Its IUPAC name is 4-bromobutyl (1R,4S,5R,9S,10S,13R)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | 4-bromobutyl (1R,4S,5R,9S,10S,13R)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 71464796 |
| Molecular Formula | C24H35BrO4 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-bromobutyl (1R,4S,5R,9S,10S,13R)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C=C1C(=O)[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)OCCCCBr)[C@@H]2CC[C@@]1(O)C3 |
| InChI | InChI=1S/C24H35BrO4/c1-16-19(26)23-11-7-17-21(2,18(23)8-12-24(16,28)15-23)9-6-10-22(17,3)20(27)29-14-5-4-13-25/h17-18,28H,1,4-15H2,2-3H3/t17-,18-,21+,22+,23+,24+/m0/s1 |
| InChIKey | SLIXENGDTNQCTD-ORMUKAMASA-N |
| XLogP | 4.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|