C29H45NO4 — CID 53477220
4-piperidin-1-ylbutyl (1R,5R,9S,10S,13R)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 53477220) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is 4-piperidin-1-ylbutyl (1R,5R,9S,10S,13R)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | 4-piperidin-1-ylbutyl (1R,5R,9S,10S,13R)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 53477220 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | 4-piperidin-1-ylbutyl (1R,5R,9S,10S,13R)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C=C1C(=O)[C@@]23CCC4[C@](C)(C(=O)OCCCCN5CCCCC5)CCC[C@@]4(C)[C@@H]2CC[C@@]1(O)C3 |
| InChI | InChI=1S/C29H45NO4/c1-21-24(31)28-14-10-22-26(2,23(28)11-15-29(21,33)20-28)12-9-13-27(22,3)25(32)34-19-8-7-18-30-16-5-4-6-17-30/h22-23,33H,1,4-20H2,2-3H3/t22?,23-,26+,27+,28+,29+/m0/s1 |
| InChIKey | AHZUXBYRFXQJSD-YQXRXWLASA-N |
| XLogP | 5.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|