C28H24O8 — CID 71466389
[(1S,2R,6R,7R,8R,9R)-6-(benzoyloxymethyl)-6,9-dihydroxy-5,10-dioxo-9-tricyclo[6.2.2.02,7]dodeca-3,11-dienyl]methyl benzoate (PubChem CID 71466389) has the molecular formula C28H24O8 and a molecular weight of 488.49 g/mol. Its IUPAC name is [(1S,2R,6R,7R,8R,9R)-6-(benzoyloxymethyl)-6,9-dihydroxy-5,10-dioxo-9-tricyclo[6.2.2.02,7]dodeca-3,11-dienyl]methyl benzoate.
| Compound Name | [(1S,2R,6R,7R,8R,9R)-6-(benzoyloxymethyl)-6,9-dihydroxy-5,10-dioxo-9-tricyclo[6.2.2.02,7]dodeca-3,11-dienyl]methyl benzoate |
|---|---|
| PubChem CID | 71466389 |
| Molecular Formula | C28H24O8 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | [(1S,2R,6R,7R,8R,9R)-6-(benzoyloxymethyl)-6,9-dihydroxy-5,10-dioxo-9-tricyclo[6.2.2.02,7]dodeca-3,11-dienyl]methyl benzoate |
| SMILES | O=C(OC[C@@]1(O)C(=O)C=C[C@@H]2[C@@H]1[C@H]1C=C[C@@H]2C(=O)[C@]1(O)COC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24O8/c29-22-14-12-19-20-11-13-21(23(19)28(22,34)16-36-26(32)18-9-5-2-6-10-18)27(33,24(20)30)15-35-25(31)17-7-3-1-4-8-17/h1-14,19-21,23,33-34H,15-16H2/t19-,20-,21+,23+,27-,28+/m0/s1 |
| InChIKey | XXUFTPBMJHFXJE-TXBBXFEFSA-N |
| XLogP | 1.92 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|