C19H24O4 — CID 71467340
(1S,2S,4R,6S,7S,8R)-4-benzyl-4,6-dihydroxy-2,7-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-3-one (PubChem CID 71467340) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (1S,2S,4R,6S,7S,8R)-4-benzyl-4,6-dihydroxy-2,7-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-3-one.
| Compound Name | (1S,2S,4R,6S,7S,8R)-4-benzyl-4,6-dihydroxy-2,7-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-3-one |
|---|---|
| PubChem CID | 71467340 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1S,2S,4R,6S,7S,8R)-4-benzyl-4,6-dihydroxy-2,7-dimethyl-11-oxatricyclo[6.2.1.02,6]undecan-3-one |
| SMILES | C[C@H]1[C@H]2CC[C@H](O2)[C@]2(C)C(=O)[C@@](O)(Cc3ccccc3)C[C@]12O |
| InChI | InChI=1S/C19H24O4/c1-12-14-8-9-15(23-14)17(2)16(20)18(21,11-19(12,17)22)10-13-6-4-3-5-7-13/h3-7,12,14-15,21-22H,8-11H2,1-2H3/t12-,14+,15-,17+,18+,19-/m0/s1 |
| InChIKey | LIOIUZLRRCBYOQ-OZSIATMZSA-N |
| XLogP | 1.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |