C19H24O4 — CID 71467311
(1S,2R,3R,6S,7S,8R)-6-hydroxy-2,7-dimethyl-3-phenylmethoxy-11-oxatricyclo[6.2.1.02,6]undecan-4-one (PubChem CID 71467311) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (1S,2R,3R,6S,7S,8R)-6-hydroxy-2,7-dimethyl-3-phenylmethoxy-11-oxatricyclo[6.2.1.02,6]undecan-4-one.
| Compound Name | (1S,2R,3R,6S,7S,8R)-6-hydroxy-2,7-dimethyl-3-phenylmethoxy-11-oxatricyclo[6.2.1.02,6]undecan-4-one |
|---|---|
| PubChem CID | 71467311 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1S,2R,3R,6S,7S,8R)-6-hydroxy-2,7-dimethyl-3-phenylmethoxy-11-oxatricyclo[6.2.1.02,6]undecan-4-one |
| SMILES | C[C@H]1[C@H]2CC[C@H](O2)[C@]2(C)[C@@H](OCc3ccccc3)C(=O)C[C@]12O |
| InChI | InChI=1S/C19H24O4/c1-12-15-8-9-16(23-15)18(2)17(14(20)10-19(12,18)21)22-11-13-6-4-3-5-7-13/h3-7,12,15-17,21H,8-11H2,1-2H3/t12-,15+,16-,17-,18+,19-/m0/s1 |
| InChIKey | UPTIMHJXUBEYEH-PMBYUEKTSA-N |
| XLogP | 2.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |