C18H24O2 — CID 10730911
(3aR,6R,6aR)-1,5,5-trimethyl-6-phenylmethoxy-1,3,3a,4,6,6a-hexahydropentalen-2-one (PubChem CID 10730911) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (3aR,6R,6aR)-1,5,5-trimethyl-6-phenylmethoxy-1,3,3a,4,6,6a-hexahydropentalen-2-one.
| Compound Name | (3aR,6R,6aR)-1,5,5-trimethyl-6-phenylmethoxy-1,3,3a,4,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 10730911 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (3aR,6R,6aR)-1,5,5-trimethyl-6-phenylmethoxy-1,3,3a,4,6,6a-hexahydropentalen-2-one |
| SMILES | CC1C(=O)C[C@H]2CC(C)(C)[C@H](OCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C18H24O2/c1-12-15(19)9-14-10-18(2,3)17(16(12)14)20-11-13-7-5-4-6-8-13/h4-8,12,14,16-17H,9-11H2,1-3H3/t12?,14-,16-,17+/m0/s1 |
| InChIKey | WVDDNQOADYUTFQ-RYLNMFRWSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |