C16H20O5 — CID 44519708
(1R,4R,5R,7R,8R)-4-hydroxy-1,5,7-trimethyl-8-phenylmethoxy-2,6-dioxabicyclo[3.2.1]octan-3-one (PubChem CID 44519708) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (1R,4R,5R,7R,8R)-4-hydroxy-1,5,7-trimethyl-8-phenylmethoxy-2,6-dioxabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,4R,5R,7R,8R)-4-hydroxy-1,5,7-trimethyl-8-phenylmethoxy-2,6-dioxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 44519708 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (1R,4R,5R,7R,8R)-4-hydroxy-1,5,7-trimethyl-8-phenylmethoxy-2,6-dioxabicyclo[3.2.1]octan-3-one |
| SMILES | C[C@H]1O[C@@]2(C)[C@@H](OCc3ccccc3)[C@]1(C)OC(=O)[C@@H]2O |
| InChI | InChI=1S/C16H20O5/c1-10-15(2)14(19-9-11-7-5-4-6-8-11)16(3,20-10)12(17)13(18)21-15/h4-8,10,12,14,17H,9H2,1-3H3/t10-,12+,14+,15-,16-/m1/s1 |
| InChIKey | HEHIAGBERCDLIR-YXLJTMCISA-N |
| XLogP | 1.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |