C16H20O3 — CID 139184796
(4aS,5R,6R,7aS)-6-hydroxy-6,7a-dimethyl-5-phenyl-3,4,4a,5-tetrahydro-2H-cyclopenta[b]pyran-7-one (PubChem CID 139184796) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (4aS,5R,6R,7aS)-6-hydroxy-6,7a-dimethyl-5-phenyl-3,4,4a,5-tetrahydro-2H-cyclopenta[b]pyran-7-one.
| Compound Name | (4aS,5R,6R,7aS)-6-hydroxy-6,7a-dimethyl-5-phenyl-3,4,4a,5-tetrahydro-2H-cyclopenta[b]pyran-7-one |
|---|---|
| PubChem CID | 139184796 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (4aS,5R,6R,7aS)-6-hydroxy-6,7a-dimethyl-5-phenyl-3,4,4a,5-tetrahydro-2H-cyclopenta[b]pyran-7-one |
| SMILES | C[C@]1(O)C(=O)[C@@]2(C)OCCC[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H20O3/c1-15(18)13(11-7-4-3-5-8-11)12-9-6-10-19-16(12,2)14(15)17/h3-5,7-8,12-13,18H,6,9-10H2,1-2H3/t12-,13-,15+,16-/m0/s1 |
| InChIKey | JBLKBBHHWXNPSM-UGQVUOCMSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |