C25H28O5 — CID 140517318
[1-benzyl-3-hydroxy-2-[(E)-1-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl] acetate (PubChem CID 140517318) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is [1-benzyl-3-hydroxy-2-[(E)-1-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl] acetate.
| Compound Name | [1-benzyl-3-hydroxy-2-[(E)-1-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl] acetate |
|---|---|
| PubChem CID | 140517318 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [1-benzyl-3-hydroxy-2-[(E)-1-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl] acetate |
| SMILES | CC(=O)OC1(Cc2ccccc2)C(=O)CC(O)C1/C(O)=C\CCCc1ccccc1 |
| InChI | InChI=1S/C25H28O5/c1-18(26)30-25(17-20-13-6-3-7-14-20)23(29)16-22(28)24(25)21(27)15-9-8-12-19-10-4-2-5-11-19/h2-7,10-11,13-15,22,24,27-28H,8-9,12,16-17H2,1H3/b21-15+ |
| InChIKey | JIPRDDSMMKPWJJ-RCCKNPSSSA-N |
| XLogP | 3.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|