C20H20O5 — CID 134873839
cis-methyl (1R,5R)-3-hydroxy-3-methoxy-2-oxo-1,5-diphenylcyclopentane-1-carboxylate (PubChem CID 134873839) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is cis-methyl (1R,5R)-3-hydroxy-3-methoxy-2-oxo-1,5-diphenylcyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1R,5R)-3-hydroxy-3-methoxy-2-oxo-1,5-diphenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134873839 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | cis-methyl (1R,5R)-3-hydroxy-3-methoxy-2-oxo-1,5-diphenylcyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)C(=O)C(O)(OC)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H20O5/c1-24-18(22)20(15-11-7-4-8-12-15)16(14-9-5-3-6-10-14)13-19(23,25-2)17(20)21/h3-12,16,23H,13H2,1-2H3/t16-,19?,20+/m1/s1 |
| InChIKey | RSAZAZHPOKFVGE-VBHUFULTSA-N |
| XLogP | 2.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|