C22H22O5 — CID 135053840
ethyl (1R,5R)-4-ethoxy-3-hydroxy-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate (PubChem CID 135053840) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is ethyl (1R,5R)-4-ethoxy-3-hydroxy-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,5R)-4-ethoxy-3-hydroxy-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 135053840 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | ethyl (1R,5R)-4-ethoxy-3-hydroxy-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)C(=O)C(O)=C(OCC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H22O5/c1-3-26-19-17(15-11-7-5-8-12-15)22(20(24)18(19)23,21(25)27-4-2)16-13-9-6-10-14-16/h5-14,17,23H,3-4H2,1-2H3/t17-,22-/m0/s1 |
| InChIKey | DCBKSWAHAFLNNV-JTSKRJEESA-N |
| XLogP | 3.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|