C23H28O2S — CID 71468145
CID 71468145 (PubChem CID 71468145) has the molecular formula C23H28O2S and a molecular weight of 368.54 g/mol.
| Compound Name | CID 71468145 |
|---|---|
| PubChem CID | 71468145 |
| Molecular Formula | C23H28O2S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | — |
| SMILES | O=C1O[C@H]2[C@@H](CCC3(CC3)[C@@H]3CCC4(CC4)[C@H]23)[C@@H]1CSc1ccccc1 |
| InChI | InChI=1S/C23H28O2S/c24-21-17(14-26-15-4-2-1-3-5-15)16-6-8-22(10-11-22)18-7-9-23(12-13-23)19(18)20(16)25-21/h1-5,16-20H,6-14H2/t16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | LUXFPYLZWLMCLJ-KNJMJIDISA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |