C15H19N5O4S2 — CID 71468803
N-[(2S)-1-[[3-(hydroxyamino)-3-oxopropyl]amino]-3-methyl-1-oxobutan-2-yl]-2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 71468803) has the molecular formula C15H19N5O4S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[(2S)-1-[[3-(hydroxyamino)-3-oxopropyl]amino]-3-methyl-1-oxobutan-2-yl]-2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2S)-1-[[3-(hydroxyamino)-3-oxopropyl]amino]-3-methyl-1-oxobutan-2-yl]-2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71468803 |
| Molecular Formula | C15H19N5O4S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[(2S)-1-[[3-(hydroxyamino)-3-oxopropyl]amino]-3-methyl-1-oxobutan-2-yl]-2-(1,3-thiazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1csc(-c2cscn2)n1)C(=O)NCCC(=O)NO |
| InChI | InChI=1S/C15H19N5O4S2/c1-8(2)12(14(23)16-4-3-11(21)20-24)19-13(22)9-6-26-15(18-9)10-5-25-7-17-10/h5-8,12,24H,3-4H2,1-2H3,(H,16,23)(H,19,22)(H,20,21)/t12-/m0/s1 |
| InChIKey | DBACUCRQRGQVQV-LBPRGKRZSA-N |
| XLogP | 1.03 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|