C16H22N4O2S2 — CID 325516
2-[2-(2-acetamidoethyl)-1,3-thiazol-4-yl]-N-pentyl-1,3-thiazole-4-carboxamide (PubChem CID 325516) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[2-(2-acetamidoethyl)-1,3-thiazol-4-yl]-N-pentyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(2-acetamidoethyl)-1,3-thiazol-4-yl]-N-pentyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 325516 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[2-(2-acetamidoethyl)-1,3-thiazol-4-yl]-N-pentyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNC(=O)C1=CSC(=N1)C2=CSC(=N2)CCNC(=O)C |
| InChI | InChI=1S/C16H22N4O2S2/c1-3-4-5-7-18-15(22)12-9-24-16(20-12)13-10-23-14(19-13)6-8-17-11(2)21/h9-10H,3-8H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | QVSZSOKCMJLSGN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | 425 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|