C20H20N2O2 — CID 71469809
1-[1H-indol-3-yl-(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 71469809) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[1H-indol-3-yl-(4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 1-[1H-indol-3-yl-(4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71469809 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[1H-indol-3-yl-(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C(c2c[nH]c3ccccc23)N2CCCC2=O)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-24-15-10-8-14(9-11-15)20(22-12-4-7-19(22)23)17-13-21-18-6-3-2-5-16(17)18/h2-3,5-6,8-11,13,20-21H,4,7,12H2,1H3 |
| InChIKey | GTDGAXNBAJOGRT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |